About 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine
6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine (PubChem CID 146245355) has the molecular formula C13H20F2N2
and a molecular weight of 242.31 g/mol. Its IUPAC name is 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine.
Molecular Properties
| Compound Name | 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine |
| PubChem CID | 146245355 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine |
| SMILES | CCCC(F)(F)C1=CC=C(N)C(C)N=C1CC |
| InChI | InChI=1S/C13H20F2N2/c1-4-8-13(14,15)10-6-7-11(16)9(3)17-12(10)5-2/h6-7,9H,4-5,8,16H2,1-3H3 |
| InChIKey | PHWBDGYYRLCEHD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine?
The IUPAC name of 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine (CID 146245355) is 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine.
What is the SMILES notation for 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine?
The canonical SMILES for 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine is CCCC(F)(F)C1=CC=C(N)C(C)N=C1CC.
What is the InChIKey of 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine?
The InChIKey is PHWBDGYYRLCEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2/c1-4-8-13(14,15)10-6-7-11(16)9(3)17-12(10)5-2/h6-7,9H,4-5,8,16H2,1-3H3.
What are the key properties of 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine?
6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine has a molecular weight of 242.31 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-difluorobutyl)-7-ethyl-2-methyl-2H-azepin-3-amine is sourced from PubChem (CID 146245355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).