About 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine
5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine (PubChem CID 146245373) has the molecular formula C9H7ClF3N
and a molecular weight of 221.61 g/mol. Its IUPAC name is 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine.
Molecular Properties
| Compound Name | 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine |
| PubChem CID | 146245373 |
| Molecular Formula | C9H7ClF3N |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine |
| SMILES | C/N=c1\ccc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3N/c1-14-8-5-3-6(10)2-4-7(8)9(11,12)13/h2-5H,1H3/b14-8+ |
| InChIKey | JSHOSUWQHMEFJM-RIYZIHGNSA-N |
| XLogP | 2.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine?
The IUPAC name of 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine (CID 146245373) is 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine.
What is the SMILES notation for 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine?
The canonical SMILES for 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine is C/N=c1\ccc(Cl)ccc1C(F)(F)F.
What is the InChIKey of 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine?
The InChIKey is JSHOSUWQHMEFJM-RIYZIHGNSA-N. The full InChI is InChI=1S/C9H7ClF3N/c1-14-8-5-3-6(10)2-4-7(8)9(11,12)13/h2-5H,1H3/b14-8+.
What are the key properties of 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine?
5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine has a molecular weight of 221.61 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-methyl-2-(trifluoromethyl)cyclohepta-2,4,6-trien-1-imine is sourced from PubChem (CID 146245373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).