C26H34N4 — CID 146245509
N-butyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine (PubChem CID 146245509) has the molecular formula C26H34N4 and a molecular weight of 402.59 g/mol. Its IUPAC name is N-butyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine.
| Compound Name | N-butyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 146245509 |
| Molecular Formula | C26H34N4 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | N-butyl-6-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-3-[(Z)-1-methyliminobut-2-en-2-yl]pyridin-2-amine |
| SMILES | C=C/C(=C\N(C)C)c1cccc(-c2ccc(C(=C/C)/C=N/C)c(NCCCC)n2)c1 |
| InChI | InChI=1S/C26H34N4/c1-7-10-16-28-26-24(20(8-2)18-27-4)14-15-25(29-26)23-13-11-12-22(17-23)21(9-3)19-30(5)6/h8-9,11-15,17-19H,3,7,10,16H2,1-2,4-6H3,(H,28,29)/b20-8+,21-19+,27-18+ |
| InChIKey | XFYJLOKMBYGLLD-IQYYGLBZSA-N |
| XLogP | 6.15 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|