C30H36N6O2 — CID 146245531
4-[3-[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]propyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidine (PubChem CID 146245531) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is 4-[3-[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]propyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidine.
| Compound Name | 4-[3-[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]propyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 146245531 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 4-[3-[(3aR,4S,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]propyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidine |
| SMILES | Cn1cc(-c2cccc(-c3ncc(-c4cnn(C)c4)c(CCC[C@H]4CCC[C@@H]5OC(C)(C)O[C@H]45)n3)c2)cn1 |
| InChI | InChI=1S/C30H36N6O2/c1-30(2)37-27-13-7-9-20(28(27)38-30)8-6-12-26-25(24-16-33-36(4)19-24)17-31-29(34-26)22-11-5-10-21(14-22)23-15-32-35(3)18-23/h5,10-11,14-20,27-28H,6-9,12-13H2,1-4H3/t20-,27-,28+/m0/s1 |
| InChIKey | WEEKMANHQCYZSF-XNZIZSAOSA-N |
| XLogP | 5.59 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |