C22H23F3N6OS — CID 146245544
3-[[2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-(5-methyl-1,3,4-thiadiazol-2-yl)pyrimidin-4-yl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 146245544) has the molecular formula C22H23F3N6OS and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-[[2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-(5-methyl-1,3,4-thiadiazol-2-yl)pyrimidin-4-yl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-(5-methyl-1,3,4-thiadiazol-2-yl)pyrimidin-4-yl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 146245544 |
| Molecular Formula | C22H23F3N6OS |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 3-[[2-[3-[(1E)-1-(dimethylamino)buta-1,3-dien-2-yl]phenyl]-5-(5-methyl-1,3,4-thiadiazol-2-yl)pyrimidin-4-yl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | C=C/C(=C\N(C)C)c1cccc(-c2ncc(-c3nnc(C)s3)c(NCC(O)C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C22H23F3N6OS/c1-5-14(12-31(3)4)15-7-6-8-16(9-15)19-26-10-17(21-30-29-13(2)33-21)20(28-19)27-11-18(32)22(23,24)25/h5-10,12,18,32H,1,11H2,2-4H3,(H,26,27,28)/b14-12+ |
| InChIKey | COUUDHNAZMAFLF-WYMLVPIESA-N |
| XLogP | 4.39 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|