C16H34N4O3S — CID 146245769
N-[2-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]morpholin-4-yl]ethyl]propan-2-amine (PubChem CID 146245769) has the molecular formula C16H34N4O3S and a molecular weight of 362.54 g/mol. Its IUPAC name is N-[2-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]morpholin-4-yl]ethyl]propan-2-amine.
| Compound Name | N-[2-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]morpholin-4-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 146245769 |
| Molecular Formula | C16H34N4O3S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-[2-[2-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]morpholin-4-yl]ethyl]propan-2-amine |
| SMILES | CC(C)NCCN1CCOC(CNCCN2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C16H34N4O3S/c1-15(2)18-4-6-20-7-10-23-16(14-20)13-17-3-5-19-8-11-24(21,22)12-9-19/h15-18H,3-14H2,1-2H3 |
| InChIKey | AUQKNLRXEBDJHJ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|