About [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine
[1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine (PubChem CID 146245942) has the molecular formula C11H15FN2
and a molecular weight of 194.25 g/mol. Its IUPAC name is [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine.
Molecular Properties
| Compound Name | [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine |
| PubChem CID | 146245942 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine |
| SMILES | NCC1=CC2C=CN(CCF)C2C=C1 |
| InChI | InChI=1S/C11H15FN2/c12-4-6-14-5-3-10-7-9(8-13)1-2-11(10)14/h1-3,5,7,10-11H,4,6,8,13H2 |
| InChIKey | OMLJAIZLRJIHPR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine?
The IUPAC name of [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine (CID 146245942) is [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine.
What is the SMILES notation for [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine?
The canonical SMILES for [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine is NCC1=CC2C=CN(CCF)C2C=C1.
What is the InChIKey of [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine?
The InChIKey is OMLJAIZLRJIHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2/c12-4-6-14-5-3-10-7-9(8-13)1-2-11(10)14/h1-3,5,7,10-11H,4,6,8,13H2.
What are the key properties of [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine?
[1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine has a molecular weight of 194.25 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-fluoroethyl)-3a,7a-dihydroindol-5-yl]methanamine is sourced from PubChem (CID 146245942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).