About 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane
4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane (PubChem CID 146245971) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane |
| PubChem CID | 146245971 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane |
| SMILES | C=CC(=C)CCC(C(=C)C)N1CCCOCC1 |
| InChI | InChI=1S/C15H25NO/c1-5-14(4)7-8-15(13(2)3)16-9-6-11-17-12-10-16/h5,15H,1-2,4,6-12H2,3H3 |
| InChIKey | UUOORSMXPUVCHO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane?
The IUPAC name of 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane (CID 146245971) is 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane.
What is the SMILES notation for 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane?
The canonical SMILES for 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane is C=CC(=C)CCC(C(=C)C)N1CCCOCC1.
What is the InChIKey of 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane?
The InChIKey is UUOORSMXPUVCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-5-14(4)7-8-15(13(2)3)16-9-6-11-17-12-10-16/h5,15H,1-2,4,6-12H2,3H3.
What are the key properties of 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane?
4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane has a molecular weight of 235.37 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-6-methylideneocta-1,7-dien-3-yl)-1,4-oxazepane is sourced from PubChem (CID 146245971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).