C59H39N3S — CID 146246095
2-(1-benzothiophen-2-yl)-4-(3-phenylphenyl)-6-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 146246095) has the molecular formula C59H39N3S and a molecular weight of 822.05 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-4-(3-phenylphenyl)-6-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(1-benzothiophen-2-yl)-4-(3-phenylphenyl)-6-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 146246095 |
| Molecular Formula | C59H39N3S |
| Molecular Weight | 822.05 g/mol |
| Exact Mass | 821.29 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-4-(3-phenylphenyl)-6-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc(-c5cc(-c6ccccc6)c(-c6ccccc6)c(-c6ccccc6)c5-c5ccccc5)cc4)nc(-c4cc5ccccc5s4)n3)c2)cc1 |
| InChI | InChI=1S/C59H39N3S/c1-6-19-40(20-7-1)47-30-18-31-49(37-47)58-60-57(61-59(62-58)53-38-48-29-16-17-32-52(48)63-53)46-35-33-42(34-36-46)51-39-50(41-21-8-2-9-22-41)54(43-23-10-3-11-24-43)56(45-27-14-5-15-28-45)55(51)44-25-12-4-13-26-44/h1-39H |
| InChIKey | UYHZINGKPWIJHY-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.05 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |