About 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one
7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one (PubChem CID 146246264) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one.
Molecular Properties
| Compound Name | 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one |
| PubChem CID | 146246264 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one |
| SMILES | CCN1CC2(COC2)OC1=O |
| InChI | InChI=1S/C7H11NO3/c1-2-8-3-7(4-10-5-7)11-6(8)9/h2-5H2,1H3 |
| InChIKey | HNGDQCNWNHMIOW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one?
The IUPAC name of 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one (CID 146246264) is 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one.
What is the SMILES notation for 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one?
The canonical SMILES for 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one is CCN1CC2(COC2)OC1=O.
What is the InChIKey of 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one?
The InChIKey is HNGDQCNWNHMIOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-8-3-7(4-10-5-7)11-6(8)9/h2-5H2,1H3.
What are the key properties of 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one?
7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one has a molecular weight of 157.17 g/mol, XLogP of 0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,5-dioxa-7-azaspiro[3.4]octan-6-one is sourced from PubChem (CID 146246264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).