C22H18Cl2N4O2S — CID 146246688
1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one (PubChem CID 146246688) has the molecular formula C22H18Cl2N4O2S and a molecular weight of 473.39 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 146246688 |
| Molecular Formula | C22H18Cl2N4O2S |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one |
| SMILES | O=c1cc(-c2cn(S)c3ncc(N4CC(O)C4)cc23)ccn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N4O2S/c23-19-2-1-13(5-20(19)24)9-26-4-3-14(6-21(26)30)18-12-28(31)22-17(18)7-15(8-25-22)27-10-16(29)11-27/h1-8,12,16,29,31H,9-11H2 |
| InChIKey | BXWBPTLKVGLUPO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|