C33H42FN4O6P — CID 146246746
ditert-butyl [3-[1-[(3-fluoro-5-methylphenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl phosphate (PubChem CID 146246746) has the molecular formula C33H42FN4O6P and a molecular weight of 640.69 g/mol. Its IUPAC name is ditert-butyl [3-[1-[(3-fluoro-5-methylphenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl phosphate.
| Compound Name | ditert-butyl [3-[1-[(3-fluoro-5-methylphenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 146246746 |
| Molecular Formula | C33H42FN4O6P |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | ditert-butyl [3-[1-[(3-fluoro-5-methylphenyl)methyl]-2-oxo-4-pyridinyl]-5-morpholin-4-ylpyrrolo[2,3-b]pyridin-1-yl]methyl phosphate |
| SMILES | Cc1cc(F)cc(Cn2ccc(-c3cn(COP(=O)(OC(C)(C)C)OC(C)(C)C)c4ncc(N5CCOCC5)cc34)cc2=O)c1 |
| InChI | InChI=1S/C33H42FN4O6P/c1-23-14-24(16-26(34)15-23)20-37-9-8-25(17-30(37)39)29-21-38(22-42-45(40,43-32(2,3)4)44-33(5,6)7)31-28(29)18-27(19-35-31)36-10-12-41-13-11-36/h8-9,14-19,21H,10-13,20,22H2,1-7H3 |
| InChIKey | ULGZVKOMNQKQGD-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 97.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|