C10H16N4 — CID 146247684
(1Z,3E)-N,N-dimethyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)penta-1,3-dien-1-amine (PubChem CID 146247684) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (1Z,3E)-N,N-dimethyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N,N-dimethyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 146247684 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (1Z,3E)-N,N-dimethyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)penta-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C/N(C)C)c1n[nH]c(C)n1 |
| InChI | InChI=1S/C10H16N4/c1-5-9(6-7-14(3)4)10-11-8(2)12-13-10/h5-7H,1-4H3,(H,11,12,13)/b7-6-,9-5+ |
| InChIKey | YMCVBZNNYITSEW-QRLJIZSYSA-N |
| XLogP | 1.59 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|