C24H39NO — CID 146248084
(2E)-N-[2-[(4R)-2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyloxan-4-yl]ethyl]-2-ethylidene-4-methylpent-3-en-1-amine (PubChem CID 146248084) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is (2E)-N-[2-[(4R)-2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyloxan-4-yl]ethyl]-2-ethylidene-4-methylpent-3-en-1-amine.
| Compound Name | (2E)-N-[2-[(4R)-2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyloxan-4-yl]ethyl]-2-ethylidene-4-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 146248084 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | (2E)-N-[2-[(4R)-2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]-2-methyloxan-4-yl]ethyl]-2-ethylidene-4-methylpent-3-en-1-amine |
| SMILES | C=C/C=C(\C=C)[C@]1(CCNC/C(C=C(C)C)=C/C)CCOC(C)(CC)C1 |
| InChI | InChI=1S/C24H39NO/c1-8-12-22(10-3)24(14-16-26-23(7,11-4)19-24)13-15-25-18-21(9-2)17-20(5)6/h8-10,12,17,25H,1,3,11,13-16,18-19H2,2,4-7H3/b21-9+,22-12+/t23?,24-/m1/s1 |
| InChIKey | YLDVEAOUVUUHFY-NQLSGJJVSA-N |
| XLogP | 6.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|