C21H35NO — CID 146248100
(2E)-N-[2-[(4R)-4-buta-1,3-dien-2-yl-2-ethyl-2-methyloxan-4-yl]ethyl]-2,4-dimethylpenta-2,4-dien-1-amine (PubChem CID 146248100) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (2E)-N-[2-[(4R)-4-buta-1,3-dien-2-yl-2-ethyl-2-methyloxan-4-yl]ethyl]-2,4-dimethylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-N-[2-[(4R)-4-buta-1,3-dien-2-yl-2-ethyl-2-methyloxan-4-yl]ethyl]-2,4-dimethylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 146248100 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (2E)-N-[2-[(4R)-4-buta-1,3-dien-2-yl-2-ethyl-2-methyloxan-4-yl]ethyl]-2,4-dimethylpenta-2,4-dien-1-amine |
| SMILES | C=CC(=C)[C@]1(CCNC/C(C)=C/C(=C)C)CCOC(C)(CC)C1 |
| InChI | InChI=1S/C21H35NO/c1-8-19(6)21(11-13-23-20(7,9-2)16-21)10-12-22-15-18(5)14-17(3)4/h8,14,22H,1,3,6,9-13,15-16H2,2,4-5,7H3/b18-14+/t20?,21-/m1/s1 |
| InChIKey | HRGKVQHVCGDEDP-MKVKCSNDSA-N |
| XLogP | 5.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|