C20H19ClN2O3S — CID 146248223
N-[1-(4-chlorophenyl)-2,2-dihydroxyethyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 146248223) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,2-dihydroxyethyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,2-dihydroxyethyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 146248223 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,2-dihydroxyethyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1ccc(-c2nc(CC(=O)NC(c3ccc(Cl)cc3)C(O)O)cs2)cc1 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-12-2-4-14(5-3-12)19-22-16(11-27-19)10-17(24)23-18(20(25)26)13-6-8-15(21)9-7-13/h2-9,11,18,20,25-26H,10H2,1H3,(H,23,24) |
| InChIKey | YCLKVJBWFPYBDT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|