C18H25NO3 — CID 146248444
(6S,7S)-6-methyl-7-phenyl-1,4-dioxa-10-azaspiro[4.9]tetradecan-11-one (PubChem CID 146248444) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (6S,7S)-6-methyl-7-phenyl-1,4-dioxa-10-azaspiro[4.9]tetradecan-11-one.
| Compound Name | (6S,7S)-6-methyl-7-phenyl-1,4-dioxa-10-azaspiro[4.9]tetradecan-11-one |
|---|---|
| PubChem CID | 146248444 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (6S,7S)-6-methyl-7-phenyl-1,4-dioxa-10-azaspiro[4.9]tetradecan-11-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)CCNC(=O)CCCC12OCCO2 |
| InChI | InChI=1S/C18H25NO3/c1-14-16(15-6-3-2-4-7-15)9-11-19-17(20)8-5-10-18(14)21-12-13-22-18/h2-4,6-7,14,16H,5,8-13H2,1H3,(H,19,20)/t14-,16-/m0/s1 |
| InChIKey | XJFNGPSFZAPMDX-HOCLYGCPSA-N |
| XLogP | 2.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |