C60H28F10N4OS — CID 146248748
N,N-bis[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-7-[9-(7-phenyldibenzofuran-3-yl)carbazol-4-yl]-2,1,3-benzothiadiazol-4-amine (PubChem CID 146248748) has the molecular formula C60H28F10N4OS and a molecular weight of 1042.96 g/mol. Its IUPAC name is N,N-bis[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-7-[9-(7-phenyldibenzofuran-3-yl)carbazol-4-yl]-2,1,3-benzothiadiazol-4-amine.
| Compound Name | N,N-bis[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-7-[9-(7-phenyldibenzofuran-3-yl)carbazol-4-yl]-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 146248748 |
| Molecular Formula | C60H28F10N4OS |
| Molecular Weight | 1042.96 g/mol |
| Exact Mass | 1042.18 |
| IUPAC Name | N,N-bis[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-7-[9-(7-phenyldibenzofuran-3-yl)carbazol-4-yl]-2,1,3-benzothiadiazol-4-amine |
| SMILES | Fc1c(F)c(F)c(-c2ccc(N(c3ccc(-c4c(F)c(F)c(F)c(F)c4F)cc3)c3ccc(-c4cccc5c4c4ccccc4n5-c4ccc5c(c4)oc4cc(-c6ccccc6)ccc45)c4nsnc34)cc2)c(F)c1F |
| InChI | InChI=1S/C60H28F10N4OS/c61-49-46(50(62)54(66)57(69)53(49)65)30-13-18-33(19-14-30)73(34-20-15-31(16-21-34)47-51(63)55(67)58(70)56(68)52(47)64)43-26-25-39(59-60(43)72-76-71-59)38-10-6-12-42-48(38)40-9-4-5-11-41(40)74(42)35-22-24-37-36-23-17-32(29-7-2-1-3-8-29)27-44(36)75-45(37)28-35/h1-28H |
| InChIKey | WGMPLBWUXOAFRJ-UHFFFAOYSA-N |
| XLogP | 18.22 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.96 |
| LogP ≤ 5 | 18.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|