C17H17N3O3S2 — CID 146249081
N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyridine-2-sulfonamide (PubChem CID 146249081) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyridine-2-sulfonamide.
| Compound Name | N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 146249081 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-(3-isothiocyanatocyclobutyl)-5-(4-methoxyphenyl)pyridine-2-sulfonamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)NC3CC(N=C=S)C3)nc2)cc1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-23-16-5-2-12(3-6-16)13-4-7-17(18-10-13)25(21,22)20-15-8-14(9-15)19-11-24/h2-7,10,14-15,20H,8-9H2,1H3 |
| InChIKey | YKOLLURPZYKVQY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|