About (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate
(1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 146249134) has the molecular formula C16H14F3NO5S
and a molecular weight of 389.35 g/mol. Its IUPAC name is (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| PubChem CID | 146249134 |
| Molecular Formula | C16H14F3NO5S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(C)ccc3c2c1C(=O)N(OS(=O)(=O)C(F)(F)F)C3(C)O |
| InChI | InChI=1S/C16H14F3NO5S/c1-8-5-7-11-13-10(8)6-4-9(2)12(13)14(21)20(15(11,3)22)25-26(23,24)16(17,18)19/h4-7,22H,1-3H3 |
| InChIKey | UTUIXZBFSDRFKG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate?
The IUPAC name of (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate (CID 146249134) is (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate.
What is the SMILES notation for (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate?
The canonical SMILES for (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate is Cc1ccc2c(C)ccc3c2c1C(=O)N(OS(=O)(=O)C(F)(F)F)C3(C)O.
What is the InChIKey of (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate?
The InChIKey is UTUIXZBFSDRFKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NO5S/c1-8-5-7-11-13-10(8)6-4-9(2)12(13)14(21)20(15(11,3)22)25-26(23,24)16(17,18)19/h4-7,22H,1-3H3.
What are the key properties of (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate?
(1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate has a molecular weight of 389.35 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-1,4,7-trimethyl-3-oxobenzo[de]isoquinolin-2-yl) trifluoromethanesulfonate is sourced from PubChem (CID 146249134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).