About 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one
4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 14624973) has the molecular formula C11H12ClNO
and a molecular weight of 209.68 g/mol. Its IUPAC name is 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 14624973 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CC(CCCl)c2ccccc2N1 |
| InChI | InChI=1S/C11H12ClNO/c12-6-5-8-7-11(14)13-10-4-2-1-3-9(8)10/h1-4,8H,5-7H2,(H,13,14) |
| InChIKey | RKESVMFIRZZEKY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one (CID 14624973) is 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one is O=C1CC(CCCl)c2ccccc2N1.
What is the InChIKey of 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is RKESVMFIRZZEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO/c12-6-5-8-7-11(14)13-10-4-2-1-3-9(8)10/h1-4,8H,5-7H2,(H,13,14).
What are the key properties of 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one?
4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 209.68 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 14624973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).