C14H15F3N2O — CID 146250240
N-[(1S)-1-(4-cyanophenyl)-2-methylbutyl]-2,2,2-trifluoroacetamide (PubChem CID 146250240) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is N-[(1S)-1-(4-cyanophenyl)-2-methylbutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S)-1-(4-cyanophenyl)-2-methylbutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 146250240 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-[(1S)-1-(4-cyanophenyl)-2-methylbutyl]-2,2,2-trifluoroacetamide |
| SMILES | CCC(C)[C@H](NC(=O)C(F)(F)F)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H15F3N2O/c1-3-9(2)12(19-13(20)14(15,16)17)11-6-4-10(8-18)5-7-11/h4-7,9,12H,3H2,1-2H3,(H,19,20)/t9?,12-/m0/s1 |
| InChIKey | JXEXFOWERYZOFV-ACGXKRRESA-N |
| XLogP | 3.32 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |