About 3-imino-2,2-dimethylcyclopentan-1-ol
3-imino-2,2-dimethylcyclopentan-1-ol (PubChem CID 146250665) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 3-imino-2,2-dimethylcyclopentan-1-ol.
Molecular Properties
| Compound Name | 3-imino-2,2-dimethylcyclopentan-1-ol |
| PubChem CID | 146250665 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 3-imino-2,2-dimethylcyclopentan-1-ol |
| SMILES | [H]/N=C1\CCC(O)C1(C)C |
| InChI | InChI=1S/C7H13NO/c1-7(2)5(8)3-4-6(7)9/h6,8-9H,3-4H2,1-2H3/b8-5+ |
| InChIKey | POSJLKUVDJZJKJ-VMPITWQZSA-N |
| XLogP | 1.19 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-2,2-dimethylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-2,2-dimethylcyclopentan-1-ol?
The IUPAC name of 3-imino-2,2-dimethylcyclopentan-1-ol (CID 146250665) is 3-imino-2,2-dimethylcyclopentan-1-ol.
What is the SMILES notation for 3-imino-2,2-dimethylcyclopentan-1-ol?
The canonical SMILES for 3-imino-2,2-dimethylcyclopentan-1-ol is [H]/N=C1\CCC(O)C1(C)C.
What is the InChIKey of 3-imino-2,2-dimethylcyclopentan-1-ol?
The InChIKey is POSJLKUVDJZJKJ-VMPITWQZSA-N. The full InChI is InChI=1S/C7H13NO/c1-7(2)5(8)3-4-6(7)9/h6,8-9H,3-4H2,1-2H3/b8-5+.
What are the key properties of 3-imino-2,2-dimethylcyclopentan-1-ol?
3-imino-2,2-dimethylcyclopentan-1-ol has a molecular weight of 127.19 g/mol, XLogP of 1.19, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-2,2-dimethylcyclopentan-1-ol is sourced from PubChem (CID 146250665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).