C48H28BrN3O2S — CID 146250996
4-bromo-7-[4-[3,6-di(dibenzofuran-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]-2,1,3-benzothiadiazole (PubChem CID 146250996) has the molecular formula C48H28BrN3O2S and a molecular weight of 790.74 g/mol. Its IUPAC name is 4-bromo-7-[4-[3,6-di(dibenzofuran-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]-2,1,3-benzothiadiazole.
| Compound Name | 4-bromo-7-[4-[3,6-di(dibenzofuran-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 146250996 |
| Molecular Formula | C48H28BrN3O2S |
| Molecular Weight | 790.74 g/mol |
| Exact Mass | 789.11 |
| IUPAC Name | 4-bromo-7-[4-[3,6-di(dibenzofuran-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]-2,1,3-benzothiadiazole |
| SMILES | Brc1ccc(-c2ccc(-n3c4c(c5cc(-c6ccc7c(c6)oc6ccccc67)ccc53)CC(c3ccc5c(c3)oc3ccccc35)C=C4)cc2)c2nsnc12 |
| InChI | InChI=1S/C48H28BrN3O2S/c49-40-20-19-33(47-48(40)51-55-50-47)27-9-15-32(16-10-27)52-41-21-13-28(30-11-17-36-34-5-1-3-7-43(34)53-45(36)25-30)23-38(41)39-24-29(14-22-42(39)52)31-12-18-37-35-6-2-4-8-44(35)54-46(37)26-31/h1-23,25-26,29H,24H2 |
| InChIKey | UHQFRKAQBAMHIU-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.74 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |