C22H17ClF2N4O3 — CID 146251013
1-[(7S)-13-chloro-11-fluoro-12-(2-fluoro-6-hydroxyphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one (PubChem CID 146251013) has the molecular formula C22H17ClF2N4O3 and a molecular weight of 458.85 g/mol. Its IUPAC name is 1-[(7S)-13-chloro-11-fluoro-12-(2-fluoro-6-hydroxyphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(7S)-13-chloro-11-fluoro-12-(2-fluoro-6-hydroxyphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146251013 |
| Molecular Formula | C22H17ClF2N4O3 |
| Molecular Weight | 458.85 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 1-[(7S)-13-chloro-11-fluoro-12-(2-fluoro-6-hydroxyphenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2c3ncnc4c(Cl)c(-c5c(O)cccc5F)c(F)c(c34)OC[C@@H]2C1 |
| InChI | InChI=1S/C22H17ClF2N4O3/c1-2-14(31)28-6-7-29-11(8-28)9-32-21-17-20(26-10-27-22(17)29)18(23)16(19(21)25)15-12(24)4-3-5-13(15)30/h2-5,10-11,30H,1,6-9H2/t11-/m0/s1 |
| InChIKey | IWJRYHPWEWTCOG-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|