C12H17NO2 — CID 146251028
(4R,7S)-9-imino-4,7-dimethyl-5-methylidenenon-1-ene-3,6-dione (PubChem CID 146251028) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (4R,7S)-9-imino-4,7-dimethyl-5-methylidenenon-1-ene-3,6-dione.
| Compound Name | (4R,7S)-9-imino-4,7-dimethyl-5-methylidenenon-1-ene-3,6-dione |
|---|---|
| PubChem CID | 146251028 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (4R,7S)-9-imino-4,7-dimethyl-5-methylidenenon-1-ene-3,6-dione |
| SMILES | [H]/N=C/C[C@H](C)C(=O)C(=C)[C@@H](C)C(=O)C=C |
| InChI | InChI=1S/C12H17NO2/c1-5-11(14)9(3)10(4)12(15)8(2)6-7-13/h5,7-9,13H,1,4,6H2,2-3H3/b13-7+/t8-,9+/m0/s1 |
| InChIKey | YSOKOBFBSGIIFE-IWLYLNEASA-N |
| XLogP | 2.18 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|