C22H26N6O2 — CID 146251464
2-[4-[(3S)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 146251464) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[4-[(3S)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-[4-[(3S)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 146251464 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-[4-[(3S)-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1CC=NN1C(=O)C1CCN(c2ncc3c(n2)NC(=O)C3)CC1 |
| InChI | InChI=1S/C22H26N6O2/c1-3-4-5-6-15(2)18-7-10-24-28(18)21(30)16-8-11-27(12-9-16)22-23-14-17-13-19(29)25-20(17)26-22/h3-6,10,14,16,18H,2,7-9,11-13H2,1H3,(H,23,25,26,29)/b4-3-,6-5-/t18-/m0/s1 |
| InChIKey | WIOZGSKPXPMYOR-OHVJWHLSSA-N |
| XLogP | 2.46 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|