C17H18FN3O3 — CID 146251810
3-[4-(4-fluorophenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal (PubChem CID 146251810) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal.
| Compound Name | 3-[4-(4-fluorophenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 146251810 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-6-morpholin-4-yl-5-oxopyrazin-2-yl]propanal |
| SMILES | O=CCCc1cn(-c2ccc(F)cc2)c(=O)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H18FN3O3/c18-13-3-5-15(6-4-13)21-12-14(2-1-9-22)19-16(17(21)23)20-7-10-24-11-8-20/h3-6,9,12H,1-2,7-8,10-11H2 |
| InChIKey | MEFDEQWZVZBTSW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|