C27H31FN4O4S — CID 146251933
5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one (PubChem CID 146251933) has the molecular formula C27H31FN4O4S and a molecular weight of 526.63 g/mol. Its IUPAC name is 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one.
| Compound Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one |
|---|---|
| PubChem CID | 146251933 |
| Molecular Formula | C27H31FN4O4S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 5-[3-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]propyl]-1-(4-methylsulfonylphenyl)-3-morpholin-4-ylpyrazin-2-one |
| SMILES | CS(=O)(=O)c1ccc(-n2cc(CCCN[C@@H]3C[C@H]3c3ccc(F)cc3)nc(N3CCOCC3)c2=O)cc1 |
| InChI | InChI=1S/C27H31FN4O4S/c1-37(34,35)23-10-8-22(9-11-23)32-18-21(30-26(27(32)33)31-13-15-36-16-14-31)3-2-12-29-25-17-24(25)19-4-6-20(28)7-5-19/h4-11,18,24-25,29H,2-3,12-17H2,1H3/t24-,25+/m0/s1 |
| InChIKey | IDLOIFLFIKQKSX-LOSJGSFVSA-N |
| XLogP | 2.69 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|