C30H27F7O3 — CID 146252263
1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-4-pentyl-2,6-dioxabicyclo[2.2.2]octane (PubChem CID 146252263) has the molecular formula C30H27F7O3 and a molecular weight of 568.53 g/mol. Its IUPAC name is 1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-4-pentyl-2,6-dioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-4-pentyl-2,6-dioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 146252263 |
| Molecular Formula | C30H27F7O3 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 1-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-4-pentyl-2,6-dioxabicyclo[2.2.2]octane |
| SMILES | CCCCCC12CCC(c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)cc3)(OC1)OC2 |
| InChI | InChI=1S/C30H27F7O3/c1-2-3-4-9-28-10-11-29(38-16-28,39-17-28)20-7-5-18(6-8-20)19-12-22(31)26(23(32)13-19)30(36,37)40-21-14-24(33)27(35)25(34)15-21/h5-8,12-15H,2-4,9-11,16-17H2,1H3 |
| InChIKey | KHUAXIXUTOBCIF-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|