About 1-ethyl-2,4-di(propan-2-yl)pyrrole
1-ethyl-2,4-di(propan-2-yl)pyrrole (PubChem CID 146252795) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-ethyl-2,4-di(propan-2-yl)pyrrole.
Molecular Properties
| Compound Name | 1-ethyl-2,4-di(propan-2-yl)pyrrole |
| PubChem CID | 146252795 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-ethyl-2,4-di(propan-2-yl)pyrrole |
| SMILES | CCn1cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C12H21N/c1-6-13-8-11(9(2)3)7-12(13)10(4)5/h7-10H,6H2,1-5H3 |
| InChIKey | KZSHIPWMZUFMHG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-2,4-di(propan-2-yl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,4-di(propan-2-yl)pyrrole?
The IUPAC name of 1-ethyl-2,4-di(propan-2-yl)pyrrole (CID 146252795) is 1-ethyl-2,4-di(propan-2-yl)pyrrole.
What is the SMILES notation for 1-ethyl-2,4-di(propan-2-yl)pyrrole?
The canonical SMILES for 1-ethyl-2,4-di(propan-2-yl)pyrrole is CCn1cc(C(C)C)cc1C(C)C.
What is the InChIKey of 1-ethyl-2,4-di(propan-2-yl)pyrrole?
The InChIKey is KZSHIPWMZUFMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-6-13-8-11(9(2)3)7-12(13)10(4)5/h7-10H,6H2,1-5H3.
What are the key properties of 1-ethyl-2,4-di(propan-2-yl)pyrrole?
1-ethyl-2,4-di(propan-2-yl)pyrrole has a molecular weight of 179.31 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,4-di(propan-2-yl)pyrrole is sourced from PubChem (CID 146252795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).