C13H10ClF2N3O2 — CID 14625290
3-chloro-2-(2,4-difluoro-5-nitrophenyl)-4,5,6,7-tetrahydroindazole (PubChem CID 14625290) has the molecular formula C13H10ClF2N3O2 and a molecular weight of 313.69 g/mol. Its IUPAC name is 3-chloro-2-(2,4-difluoro-5-nitrophenyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-chloro-2-(2,4-difluoro-5-nitrophenyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 14625290 |
| Molecular Formula | C13H10ClF2N3O2 |
| Molecular Weight | 313.69 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 3-chloro-2-(2,4-difluoro-5-nitrophenyl)-4,5,6,7-tetrahydroindazole |
| SMILES | O=[N+]([O-])c1cc(-n2nc3c(c2Cl)CCCC3)c(F)cc1F |
| InChI | InChI=1S/C13H10ClF2N3O2/c14-13-7-3-1-2-4-10(7)17-18(13)11-6-12(19(20)21)9(16)5-8(11)15/h5-6H,1-4H2 |
| InChIKey | HYYSURMRUOXLCZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|