C22H22N6OS — CID 146253353
3-methyl-4-(3-phenylmethoxypropyl)-11-pyrazol-1-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 146253353) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 3-methyl-4-(3-phenylmethoxypropyl)-11-pyrazol-1-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 3-methyl-4-(3-phenylmethoxypropyl)-11-pyrazol-1-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 146253353 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-methyl-4-(3-phenylmethoxypropyl)-11-pyrazol-1-yl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | Cn1c(CCCOCc2ccccc2)nc2c(N)nc3cc(-n4cccn4)sc3c21 |
| InChI | InChI=1S/C22H22N6OS/c1-27-17(9-5-12-29-14-15-7-3-2-4-8-15)26-19-20(27)21-16(25-22(19)23)13-18(30-21)28-11-6-10-24-28/h2-4,6-8,10-11,13H,5,9,12,14H2,1H3,(H2,23,25) |
| InChIKey | KTZRYGRBNZKUPG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|