C10H9N3O2S2 — CID 146253381
3-methyl-4-methylsulfonyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 146253381) has the molecular formula C10H9N3O2S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-methyl-4-methylsulfonyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 3-methyl-4-methylsulfonyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 146253381 |
| Molecular Formula | C10H9N3O2S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3-methyl-4-methylsulfonyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | Cn1c(S(C)(=O)=O)nc2cnc3ccsc3c21 |
| InChI | InChI=1S/C10H9N3O2S2/c1-13-8-7(12-10(13)17(2,14)15)5-11-6-3-4-16-9(6)8/h3-5H,1-2H3 |
| InChIKey | MLSIWVZVFNQXAN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |