C24H25N7OS — CID 146253457
3-methyl-4-(4-phenylmethoxypiperidin-1-yl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 146253457) has the molecular formula C24H25N7OS and a molecular weight of 459.58 g/mol. Its IUPAC name is 3-methyl-4-(4-phenylmethoxypiperidin-1-yl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 3-methyl-4-(4-phenylmethoxypiperidin-1-yl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 146253457 |
| Molecular Formula | C24H25N7OS |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-methyl-4-(4-phenylmethoxypiperidin-1-yl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | Cn1c(N2CCC(OCc3ccccc3)CC2)nc2c(N)nc3cc(-c4ccn[nH]4)sc3c21 |
| InChI | InChI=1S/C24H25N7OS/c1-30-21-20(23(25)27-18-13-19(33-22(18)21)17-7-10-26-29-17)28-24(30)31-11-8-16(9-12-31)32-14-15-5-3-2-4-6-15/h2-7,10,13,16H,8-9,11-12,14H2,1H3,(H2,25,27)(H,26,29) |
| InChIKey | AGSUMRHMQZEGFW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |