C15H31F3N2S — CID 146254139
3-methyl-6-N-(4-methylsulfanylbutyl)-1-N-(2,2,2-trifluoroethyl)heptane-1,6-diamine (PubChem CID 146254139) has the molecular formula C15H31F3N2S and a molecular weight of 328.49 g/mol. Its IUPAC name is 3-methyl-6-N-(4-methylsulfanylbutyl)-1-N-(2,2,2-trifluoroethyl)heptane-1,6-diamine.
| Compound Name | 3-methyl-6-N-(4-methylsulfanylbutyl)-1-N-(2,2,2-trifluoroethyl)heptane-1,6-diamine |
|---|---|
| PubChem CID | 146254139 |
| Molecular Formula | C15H31F3N2S |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 3-methyl-6-N-(4-methylsulfanylbutyl)-1-N-(2,2,2-trifluoroethyl)heptane-1,6-diamine |
| SMILES | CSCCCCNC(C)CCC(C)CCNCC(F)(F)F |
| InChI | InChI=1S/C15H31F3N2S/c1-13(8-10-19-12-15(16,17)18)6-7-14(2)20-9-4-5-11-21-3/h13-14,19-20H,4-12H2,1-3H3 |
| InChIKey | QVGXQKAKEKRKCJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|