C37H42N4O6S — CID 146254179
(3S)-N-[(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-2-(4-oxo-4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 146254179) has the molecular formula C37H42N4O6S and a molecular weight of 670.83 g/mol. Its IUPAC name is (3S)-N-[(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-2-(4-oxo-4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-N-[(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-2-(4-oxo-4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 146254179 |
| Molecular Formula | C37H42N4O6S |
| Molecular Weight | 670.83 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | (3S)-N-[(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-2-(4-oxo-4-phenylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | O=C(CCC(=O)N1Cc2ccccc2C[C@H]1C(=O)N[C@@H](CCN1CCS(=O)(=O)CC1)C(=O)Nc1ccc2c(c1)CCC2)c1ccccc1 |
| InChI | InChI=1S/C37H42N4O6S/c42-34(27-7-2-1-3-8-27)15-16-35(43)41-25-30-10-5-4-9-29(30)24-33(41)37(45)39-32(17-18-40-19-21-48(46,47)22-20-40)36(44)38-31-14-13-26-11-6-12-28(26)23-31/h1-5,7-10,13-14,23,32-33H,6,11-12,15-22,24-25H2,(H,38,44)(H,39,45)/t32-,33-/m0/s1 |
| InChIKey | CCUXHEXMWNENAM-LQJZCPKCSA-N |
| XLogP | 3.34 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |