About cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one
cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 146255597) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one |
| PubChem CID | 146255597 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.N#CO |
| InChI | InChI=1S/C9H14O.CHNO/c1-7-4-8(10)6-9(2,3)5-7;2-1-3/h4H,5-6H2,1-3H3;3H |
| InChIKey | IKGRHMKNUHTLIL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one?
The IUPAC name of cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one (CID 146255597) is cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one?
The canonical SMILES for cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one is CC1=CC(=O)CC(C)(C)C1.N#CO.
What is the InChIKey of cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one?
The InChIKey is IKGRHMKNUHTLIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.CHNO/c1-7-4-8(10)6-9(2,3)5-7;2-1-3/h4H,5-6H2,1-3H3;3H.
What are the key properties of cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one?
cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one has a molecular weight of 181.23 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;3,5,5-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 146255597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).