About 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide
2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide (PubChem CID 146255629) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide.
Molecular Properties
| Compound Name | 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide |
| PubChem CID | 146255629 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide |
| SMILES | C/C=C(C)\C=C/CCNCC(N)=O |
| InChI | InChI=1S/C10H18N2O/c1-3-9(2)6-4-5-7-12-8-10(11)13/h3-4,6,12H,5,7-8H2,1-2H3,(H2,11,13)/b6-4-,9-3- |
| InChIKey | KVEQJDSFPJYHHK-NQQXAEPDSA-N |
| XLogP | 0.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide?
The IUPAC name of 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide (CID 146255629) is 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide.
What is the SMILES notation for 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide?
The canonical SMILES for 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide is C/C=C(C)\C=C/CCNCC(N)=O.
What is the InChIKey of 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide?
The InChIKey is KVEQJDSFPJYHHK-NQQXAEPDSA-N. The full InChI is InChI=1S/C10H18N2O/c1-3-9(2)6-4-5-7-12-8-10(11)13/h3-4,6,12H,5,7-8H2,1-2H3,(H2,11,13)/b6-4-,9-3-.
What are the key properties of 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide?
2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide has a molecular weight of 182.27 g/mol, XLogP of 0.97, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3Z,5Z)-5-methylhepta-3,5-dienyl]amino]acetamide is sourced from PubChem (CID 146255629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).