C28H27N5O2 — CID 146255695
1-[2-[8-amino-1-[4-(2-phenylethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 146255695) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 1-[2-[8-amino-1-[4-(2-phenylethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[2-[8-amino-1-[4-(2-phenylethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 146255695 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-[2-[8-amino-1-[4-(2-phenylethoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCC1c1nc(-c2ccc(OCCc3ccccc3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C28H27N5O2/c1-2-7-24(34)32-17-6-10-23(32)28-31-25(26-27(29)30-16-18-33(26)28)21-11-13-22(14-12-21)35-19-15-20-8-4-3-5-9-20/h3-5,8-9,11-14,16,18,23H,6,10,15,17,19H2,1H3,(H2,29,30) |
| InChIKey | NBFBXAQVTNPYPV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|