About N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide
N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide (PubChem CID 146256251) has the molecular formula C15H31N3O
and a molecular weight of 269.43 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide |
| PubChem CID | 146256251 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide |
| SMILES | CC(C)(CN)CNC(=O)C1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H31N3O/c1-14(2,3)18-8-6-12(7-9-18)13(19)17-11-15(4,5)10-16/h12H,6-11,16H2,1-5H3,(H,17,19) |
| InChIKey | CJLAJTVBSNQRLN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide?
The IUPAC name of N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide (CID 146256251) is N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide?
The canonical SMILES for N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide is CC(C)(CN)CNC(=O)C1CCN(C(C)(C)C)CC1.
What is the InChIKey of N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide?
The InChIKey is CJLAJTVBSNQRLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O/c1-14(2,3)18-8-6-12(7-9-18)13(19)17-11-15(4,5)10-16/h12H,6-11,16H2,1-5H3,(H,17,19).
What are the key properties of N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide?
N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide has a molecular weight of 269.43 g/mol, XLogP of 1.60, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylpropyl)-1-tert-butylpiperidine-4-carboxamide is sourced from PubChem (CID 146256251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).