C19H35N3O2 — CID 146256273
(1-tert-butylpiperidin-4-yl)-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 146256273) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is (1-tert-butylpiperidin-4-yl)-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (1-tert-butylpiperidin-4-yl)-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 146256273 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | (1-tert-butylpiperidin-4-yl)-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC(C)(C)N1CCC(C(=O)N2CCC(CN3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C19H35N3O2/c1-19(2,3)22-8-5-17(6-9-22)18(23)21-7-4-16(15-21)14-20-10-12-24-13-11-20/h16-17H,4-15H2,1-3H3 |
| InChIKey | JHOSYUIJMLAJGY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |