C19H36O3 — CID 146256413
(4R)-4-[(E,3S)-6-ethyl-8-methoxy-2,3-dimethyloct-6-enyl]-2-propyl-1,3-dioxolane (PubChem CID 146256413) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is (4R)-4-[(E,3S)-6-ethyl-8-methoxy-2,3-dimethyloct-6-enyl]-2-propyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(E,3S)-6-ethyl-8-methoxy-2,3-dimethyloct-6-enyl]-2-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 146256413 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (4R)-4-[(E,3S)-6-ethyl-8-methoxy-2,3-dimethyloct-6-enyl]-2-propyl-1,3-dioxolane |
| SMILES | CCCC1OC[C@@H](CC(C)[C@@H](C)CC/C(=C/COC)CC)O1 |
| InChI | InChI=1S/C19H36O3/c1-6-8-19-21-14-18(22-19)13-16(4)15(3)9-10-17(7-2)11-12-20-5/h11,15-16,18-19H,6-10,12-14H2,1-5H3/b17-11+/t15-,16?,18+,19?/m0/s1 |
| InChIKey | VBYRKPYSBKRUDD-LFGGFDAOSA-N |
| XLogP | 4.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|