About cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid
cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid (PubChem CID 146256670) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid.
Analyze cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid (CID 146256670) is cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid is O=C(O)[C@H]1C[C@@H]1CCO.
What is the InChIKey of cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid?
The InChIKey is FNPSWTGVDMIDCZ-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H10O3/c7-2-1-4-3-5(4)6(8)9/h4-5,7H,1-3H2,(H,8,9)/t4-,5-/m0/s1.
What are the key properties of cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid?
cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid has a molecular weight of 130.14 g/mol, XLogP of 0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-(2-hydroxyethyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 146256670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).