C30H44N8O4 — CID 146257288
(2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-methylamino]-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide (PubChem CID 146257288) has the molecular formula C30H44N8O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-methylamino]-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-methylamino]-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146257288 |
| Molecular Formula | C30H44N8O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-methylamino]-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide |
| SMILES | CN(C(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)Cc1cccc2ccccc12)[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C30H44N8O4/c1-37(24(27(32)40)14-7-17-35-30(33)34)29(42)23(13-4-5-16-31)36-28(41)25-15-8-18-38(25)26(39)19-21-11-6-10-20-9-2-3-12-22(20)21/h2-3,6,9-12,23-25H,4-5,7-8,13-19,31H2,1H3,(H2,32,40)(H,36,41)(H4,33,34,35)/t23-,24-,25-/m0/s1 |
| InChIKey | JEHATWUEMDAARD-SDHOMARFSA-N |
| XLogP | 0.35 |
| TPSA | 203.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|