C29H41BrN8O4 — CID 146257289
(2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-bromonaphthalen-1-yl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 146257289) has the molecular formula C29H41BrN8O4 and a molecular weight of 645.60 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-bromonaphthalen-1-yl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-bromonaphthalen-1-yl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146257289 |
| Molecular Formula | C29H41BrN8O4 |
| Molecular Weight | 645.60 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-bromonaphthalen-1-yl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)Cc1ccc(Br)c2ccccc12)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C29H41BrN8O4/c30-21-13-12-18(19-7-1-2-8-20(19)21)17-25(39)38-16-6-11-24(38)28(42)37-23(9-3-4-14-31)27(41)36-22(26(32)40)10-5-15-35-29(33)34/h1-2,7-8,12-13,22-24H,3-6,9-11,14-17,31H2,(H2,32,40)(H,36,41)(H,37,42)(H4,33,34,35)/t22-,23-,24-/m0/s1 |
| InChIKey | XRIWCRQQORCRHU-HJOGWXRNSA-N |
| XLogP | 0.77 |
| TPSA | 212.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.60 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|