About 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol
4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol (PubChem CID 146257718) has the molecular formula C26H21O4P
and a molecular weight of 428.42 g/mol. Its IUPAC name is 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol |
| PubChem CID | 146257718 |
| Molecular Formula | C26H21O4P |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol |
| SMILES | CC(c1ccccc1)(c1ccc(O)cc1O)P1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H21O4P/c1-26(18-9-3-2-4-10-18,22-16-15-19(27)17-23(22)28)31(29)25-14-8-6-12-21(25)20-11-5-7-13-24(20)30-31/h2-17,27-28H,1H3 |
| InChIKey | LLXRIZYOEXAMCY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol?
The IUPAC name of 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol (CID 146257718) is 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol.
What is the SMILES notation for 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol?
The canonical SMILES for 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol is CC(c1ccccc1)(c1ccc(O)cc1O)P1(=O)Oc2ccccc2-c2ccccc21.
What is the InChIKey of 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol?
The InChIKey is LLXRIZYOEXAMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21O4P/c1-26(18-9-3-2-4-10-18,22-16-15-19(27)17-23(22)28)31(29)25-14-8-6-12-21(25)20-11-5-7-13-24(20)30-31/h2-17,27-28H,1H3.
What are the key properties of 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol?
4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol has a molecular weight of 428.42 g/mol, XLogP of 6.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)-1-phenylethyl]benzene-1,3-diol is sourced from PubChem (CID 146257718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).