C24H25F6N3O5 — CID 146257842
2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-pyridin-2-ylphenoxy]-2-methylpropanoic acid (PubChem CID 146257842) has the molecular formula C24H25F6N3O5 and a molecular weight of 549.47 g/mol. Its IUPAC name is 2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-pyridin-2-ylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-pyridin-2-ylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 146257842 |
| Molecular Formula | C24H25F6N3O5 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 2-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-pyridin-2-ylphenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1cc(-c2ccccn2)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1)C(=O)O |
| InChI | InChI=1S/C24H25F6N3O5/c1-22(2,20(34)35)38-18-13-15(17-5-3-4-8-31-17)6-7-16(18)14-32-9-11-33(12-10-32)21(36)37-19(23(25,26)27)24(28,29)30/h3-8,13,19H,9-12,14H2,1-2H3,(H,34,35) |
| InChIKey | PVYLMUUBNJMZSU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |