C28H38N6O — CID 146258284
1-[2-[4-[2-(2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethoxy]-N-methylmethanamine (PubChem CID 146258284) has the molecular formula C28H38N6O and a molecular weight of 474.65 g/mol. Its IUPAC name is 1-[2-[4-[2-(2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethoxy]-N-methylmethanamine.
| Compound Name | 1-[2-[4-[2-(2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethoxy]-N-methylmethanamine |
|---|---|
| PubChem CID | 146258284 |
| Molecular Formula | C28H38N6O |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 1-[2-[4-[2-(2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethoxy]-N-methylmethanamine |
| SMILES | CNCOCCN1CCC(c2ccc3[nH]c(-c4cn5nc(C)nc5cc4C)c(C(C)C)c3c2)CC1 |
| InChI | InChI=1S/C28H38N6O/c1-18(2)27-23-15-22(21-8-10-33(11-9-21)12-13-35-17-29-5)6-7-25(23)31-28(27)24-16-34-26(14-19(24)3)30-20(4)32-34/h6-7,14-16,18,21,29,31H,8-13,17H2,1-5H3 |
| InChIKey | UNIOQURGAQURIN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|