C13H21N3O3S — CID 146258940
S-[(2E,4E)-6-nitro-5-(oxan-4-ylmethylamino)hepta-2,4,6-trien-2-yl]thiohydroxylamine (PubChem CID 146258940) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is S-[(2E,4E)-6-nitro-5-(oxan-4-ylmethylamino)hepta-2,4,6-trien-2-yl]thiohydroxylamine.
| Compound Name | S-[(2E,4E)-6-nitro-5-(oxan-4-ylmethylamino)hepta-2,4,6-trien-2-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 146258940 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | S-[(2E,4E)-6-nitro-5-(oxan-4-ylmethylamino)hepta-2,4,6-trien-2-yl]thiohydroxylamine |
| SMILES | C=C(/C(=C\C=C(/C)SN)NCC1CCOCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O3S/c1-10(20-14)3-4-13(11(2)16(17)18)15-9-12-5-7-19-8-6-12/h3-4,12,15H,2,5-9,14H2,1H3/b10-3+,13-4+ |
| InChIKey | ZVHIZRFRTNYDFN-HXBDABSOSA-N |
| XLogP | 2.19 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|